C32H41F3O2 — CID 89430258
1-[4-[2-(4-but-3-enoxy-2-fluorophenyl)ethyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene (PubChem CID 89430258) has the molecular formula C32H41F3O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 1-[4-[2-(4-but-3-enoxy-2-fluorophenyl)ethyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene.
| Compound Name | 1-[4-[2-(4-but-3-enoxy-2-fluorophenyl)ethyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430258 |
| Molecular Formula | C32H41F3O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 1-[4-[2-(4-but-3-enoxy-2-fluorophenyl)ethyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(CCC2CCC(c3ccc(C4CCC(OCC)CC4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C32H41F3O2/c1-3-5-20-37-27-17-14-25(30(33)21-27)11-8-22-6-9-23(10-7-22)28-18-19-29(32(35)31(28)34)24-12-15-26(16-13-24)36-4-2/h3,14,17-19,21-24,26H,1,4-13,15-16,20H2,2H3 |
| InChIKey | ICXULUVDWFZASU-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|