C34H45F3O2 — CID 89429642
1-(4-butoxycyclohexyl)-4-[(E)-2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluorobenzene (PubChem CID 89429642) has the molecular formula C34H45F3O2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 1-(4-butoxycyclohexyl)-4-[(E)-2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-butoxycyclohexyl)-4-[(E)-2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89429642 |
| Molecular Formula | C34H45F3O2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 1-(4-butoxycyclohexyl)-4-[(E)-2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethenyl]-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(C2CCC(/C=C/c3ccc(C4CCC(OCCCC)CC4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C34H45F3O2/c1-3-5-21-38-28-16-13-26(14-17-28)31-19-15-27(33(36)34(31)37)12-9-24-7-10-25(11-8-24)30-20-18-29(23-32(30)35)39-22-6-4-2/h9,12,15,18-20,23-26,28H,3-8,10-11,13-14,16-17,21-22H2,1-2H3/b12-9+ |
| InChIKey | IZUVEEVMJULMKQ-FMIVXFBMSA-N |
| XLogP | 10.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|