C31H36F4O2 — CID 89430040
1-[4-[(E)-2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethenyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene (PubChem CID 89430040) has the molecular formula C31H36F4O2 and a molecular weight of 516.62 g/mol. Its IUPAC name is 1-[4-[(E)-2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethenyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene.
| Compound Name | 1-[4-[(E)-2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethenyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430040 |
| Molecular Formula | C31H36F4O2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 1-[4-[(E)-2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethenyl]cyclohexyl]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene |
| SMILES | C=CCOc1ccc(/C=C/C2CCC(c3ccc(C4CCC(OCC)CC4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C31H36F4O2/c1-3-19-37-27-18-13-23(28(32)31(27)35)10-7-20-5-8-21(9-6-20)25-16-17-26(30(34)29(25)33)22-11-14-24(15-12-22)36-4-2/h3,7,10,13,16-18,20-22,24H,1,4-6,8-9,11-12,14-15,19H2,2H3/b10-7+ |
| InChIKey | XHBALWXJKLITCD-JXMROGBWSA-N |
| XLogP | 8.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|