C34H42F4O2 — CID 89430679
1-but-3-enoxy-4-[(E)-2-[4-[4-(4-butoxycyclohexyl)-2,3-difluorophenyl]cyclohexyl]ethenyl]-2,3-difluorobenzene (PubChem CID 89430679) has the molecular formula C34H42F4O2 and a molecular weight of 558.70 g/mol. Its IUPAC name is 1-but-3-enoxy-4-[(E)-2-[4-[4-(4-butoxycyclohexyl)-2,3-difluorophenyl]cyclohexyl]ethenyl]-2,3-difluorobenzene.
| Compound Name | 1-but-3-enoxy-4-[(E)-2-[4-[4-(4-butoxycyclohexyl)-2,3-difluorophenyl]cyclohexyl]ethenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430679 |
| Molecular Formula | C34H42F4O2 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 1-but-3-enoxy-4-[(E)-2-[4-[4-(4-butoxycyclohexyl)-2,3-difluorophenyl]cyclohexyl]ethenyl]-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(/C=C/C2CCC(c3ccc(C4CCC(OCCCC)CC4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C34H42F4O2/c1-3-5-21-39-27-16-13-25(14-17-27)29-19-18-28(32(36)33(29)37)24-10-7-23(8-11-24)9-12-26-15-20-30(34(38)31(26)35)40-22-6-4-2/h4,9,12,15,18-20,23-25,27H,2-3,5-8,10-11,13-14,16-17,21-22H2,1H3/b12-9+ |
| InChIKey | DEPVQNUFBOGWKT-FMIVXFBMSA-N |
| XLogP | 10.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|