C25H27F3O2 — CID 143875193
4-[(E)-2-[4-(2,3-difluoro-4-pent-4-enoxyphenyl)cyclohexyl]ethenyl]-3-fluorophenol (PubChem CID 143875193) has the molecular formula C25H27F3O2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-[(E)-2-[4-(2,3-difluoro-4-pent-4-enoxyphenyl)cyclohexyl]ethenyl]-3-fluorophenol.
| Compound Name | 4-[(E)-2-[4-(2,3-difluoro-4-pent-4-enoxyphenyl)cyclohexyl]ethenyl]-3-fluorophenol |
|---|---|
| PubChem CID | 143875193 |
| Molecular Formula | C25H27F3O2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-[(E)-2-[4-(2,3-difluoro-4-pent-4-enoxyphenyl)cyclohexyl]ethenyl]-3-fluorophenol |
| SMILES | C=CCCCOc1ccc(C2CCC(/C=C/c3ccc(O)cc3F)CC2)c(F)c1F |
| InChI | InChI=1S/C25H27F3O2/c1-2-3-4-15-30-23-14-13-21(24(27)25(23)28)18-8-5-17(6-9-18)7-10-19-11-12-20(29)16-22(19)26/h2,7,10-14,16-18,29H,1,3-6,8-9,15H2/b10-7+ |
| InChIKey | RGCICIRUJAYHHQ-JXMROGBWSA-N |
| XLogP | 7.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|