C23H25F3O3 — CID 147479456
4-[[4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl]methoxy]-3-fluorophenol (PubChem CID 147479456) has the molecular formula C23H25F3O3 and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-[[4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl]methoxy]-3-fluorophenol.
| Compound Name | 4-[[4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl]methoxy]-3-fluorophenol |
|---|---|
| PubChem CID | 147479456 |
| Molecular Formula | C23H25F3O3 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-[[4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl]methoxy]-3-fluorophenol |
| SMILES | C=CCCOc1ccc(C2CCC(COc3ccc(O)cc3F)CC2)c(F)c1F |
| InChI | InChI=1S/C23H25F3O3/c1-2-3-12-28-21-11-9-18(22(25)23(21)26)16-6-4-15(5-7-16)14-29-20-10-8-17(27)13-19(20)24/h2,8-11,13,15-16,27H,1,3-7,12,14H2 |
| InChIKey | FDIMEMGNFVZTIB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|