C24H36F2O — CID 121336050
1-but-3-enoxy-2,3-difluoro-4-[4-(4-methylheptyl)cyclohexyl]benzene (PubChem CID 121336050) has the molecular formula C24H36F2O and a molecular weight of 378.55 g/mol. Its IUPAC name is 1-but-3-enoxy-2,3-difluoro-4-[4-(4-methylheptyl)cyclohexyl]benzene.
| Compound Name | 1-but-3-enoxy-2,3-difluoro-4-[4-(4-methylheptyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 121336050 |
| Molecular Formula | C24H36F2O |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-but-3-enoxy-2,3-difluoro-4-[4-(4-methylheptyl)cyclohexyl]benzene |
| SMILES | C=CCCOc1ccc(C2CCC(CCCC(C)CCC)CC2)c(F)c1F |
| InChI | InChI=1S/C24H36F2O/c1-4-6-17-27-22-16-15-21(23(25)24(22)26)20-13-11-19(12-14-20)10-7-9-18(3)8-5-2/h4,15-16,18-20H,1,5-14,17H2,2-3H3 |
| InChIKey | QUICWOZAWQMAJQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|