C35H44F4O — CID 118886202
1-but-3-enoxy-4-[2,3-difluoro-4-[4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]-2,3-difluorobenzene (PubChem CID 118886202) has the molecular formula C35H44F4O and a molecular weight of 556.73 g/mol. Its IUPAC name is 1-but-3-enoxy-4-[2,3-difluoro-4-[4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-but-3-enoxy-4-[2,3-difluoro-4-[4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 118886202 |
| Molecular Formula | C35H44F4O |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 1-but-3-enoxy-4-[2,3-difluoro-4-[4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(-c2ccc(C3CCC(CC/C=C/C4CCC(CCC)CC4)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C35H44F4O/c1-3-5-23-40-31-22-21-30(34(38)35(31)39)29-20-19-28(32(36)33(29)37)27-17-15-26(16-18-27)10-7-6-9-25-13-11-24(8-4-2)12-14-25/h3,6,9,19-22,24-27H,1,4-5,7-8,10-18,23H2,2H3/b9-6+ |
| InChIKey | SBTOTMSPLNSJIL-RMKNXTFCSA-N |
| XLogP | 11.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|