C33H43F3O — CID 118888425
1-butoxy-2,3-difluoro-4-[2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene (PubChem CID 118888425) has the molecular formula C33H43F3O and a molecular weight of 512.70 g/mol. Its IUPAC name is 1-butoxy-2,3-difluoro-4-[2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene.
| Compound Name | 1-butoxy-2,3-difluoro-4-[2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 118888425 |
| Molecular Formula | C33H43F3O |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | 1-butoxy-2,3-difluoro-4-[2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene |
| SMILES | CCCCOc1ccc(-c2ccc(C3CCC(CC/C=C/C4CCC(C)CC4)CC3)cc2F)c(F)c1F |
| InChI | InChI=1S/C33H43F3O/c1-3-4-21-37-31-20-19-29(32(35)33(31)36)28-18-17-27(22-30(28)34)26-15-13-25(14-16-26)8-6-5-7-24-11-9-23(2)10-12-24/h5,7,17-20,22-26H,3-4,6,8-16,21H2,1-2H3/b7-5+ |
| InChIKey | YURGLKXWGFQBBS-FNORWQNLSA-N |
| XLogP | 10.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|