C28H40F4O — CID 139629293
2-fluoro-4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]-1-(trifluoromethoxy)benzene (PubChem CID 139629293) has the molecular formula C28H40F4O and a molecular weight of 468.62 g/mol. Its IUPAC name is 2-fluoro-4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 139629293 |
| Molecular Formula | C28H40F4O |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 2-fluoro-4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]-1-(trifluoromethoxy)benzene |
| SMILES | CCCCCC1CCC(/C=C/CCC2CCC(c3ccc(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H40F4O/c1-2-3-4-7-21-10-12-22(13-11-21)8-5-6-9-23-14-16-24(17-15-23)25-18-19-27(26(29)20-25)33-28(30,31)32/h5,8,18-24H,2-4,6-7,9-17H2,1H3/b8-5+ |
| InChIKey | LHEYTUIETKPHEN-VMPITWQZSA-N |
| XLogP | 9.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|