C31H33F3O3 — CID 89429595
1-[[4-(4-but-3-enoxy-3-fluorophenyl)cyclohexyl]methoxy]-4-(4-ethoxyphenyl)-2,3-difluorobenzene (PubChem CID 89429595) has the molecular formula C31H33F3O3 and a molecular weight of 510.60 g/mol. Its IUPAC name is 1-[[4-(4-but-3-enoxy-3-fluorophenyl)cyclohexyl]methoxy]-4-(4-ethoxyphenyl)-2,3-difluorobenzene.
| Compound Name | 1-[[4-(4-but-3-enoxy-3-fluorophenyl)cyclohexyl]methoxy]-4-(4-ethoxyphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89429595 |
| Molecular Formula | C31H33F3O3 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 1-[[4-(4-but-3-enoxy-3-fluorophenyl)cyclohexyl]methoxy]-4-(4-ethoxyphenyl)-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(C2CCC(COc3ccc(-c4ccc(OCC)cc4)c(F)c3F)CC2)cc1F |
| InChI | InChI=1S/C31H33F3O3/c1-3-5-18-36-28-16-12-24(19-27(28)32)22-8-6-21(7-9-22)20-37-29-17-15-26(30(33)31(29)34)23-10-13-25(14-11-23)35-4-2/h3,10-17,19,21-22H,1,4-9,18,20H2,2H3 |
| InChIKey | BTIDQFCEKITUIT-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|