C30H37F3O3 — CID 89429785
1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[[4-(3-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]methoxy]benzene (PubChem CID 89429785) has the molecular formula C30H37F3O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is 1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[[4-(3-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]methoxy]benzene.
| Compound Name | 1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[[4-(3-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 89429785 |
| Molecular Formula | C30H37F3O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[[4-(3-fluoro-4-prop-2-enoxyphenyl)cyclohexyl]methoxy]benzene |
| SMILES | C=CCOc1ccc(C2CCC(COc3ccc(C4CCC(OCC)CC4)c(F)c3F)CC2)cc1F |
| InChI | InChI=1S/C30H37F3O3/c1-3-17-35-27-15-11-23(18-26(27)31)21-7-5-20(6-8-21)19-36-28-16-14-25(29(32)30(28)33)22-9-12-24(13-10-22)34-4-2/h3,11,14-16,18,20-22,24H,1,4-10,12-13,17,19H2,2H3 |
| InChIKey | MSJXIKWZLZBEGM-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|