C29H35F3O — CID 77469245
1-[4-(4-ethoxy-3-fluorophenyl)cyclohexyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene (PubChem CID 77469245) has the molecular formula C29H35F3O and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-[4-(4-ethoxy-3-fluorophenyl)cyclohexyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene.
| Compound Name | 1-[4-(4-ethoxy-3-fluorophenyl)cyclohexyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene |
|---|---|
| PubChem CID | 77469245 |
| Molecular Formula | C29H35F3O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1-[4-(4-ethoxy-3-fluorophenyl)cyclohexyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene |
| SMILES | CC=CC1CCC(c2ccc(C3CCC(c4ccc(OCC)c(F)c4)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H35F3O/c1-3-5-19-6-8-21(9-7-19)24-15-16-25(29(32)28(24)31)22-12-10-20(11-13-22)23-14-17-27(33-4-2)26(30)18-23/h3,5,14-22H,4,6-13H2,1-2H3 |
| InChIKey | VUNJORFIOCRTOV-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|