C30H35F3O2 — CID 88964237
2-[4-[[4-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]cyclohexyl]methoxy]-3-fluorophenyl]oxirane (PubChem CID 88964237) has the molecular formula C30H35F3O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[4-[[4-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]cyclohexyl]methoxy]-3-fluorophenyl]oxirane.
| Compound Name | 2-[4-[[4-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]cyclohexyl]methoxy]-3-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 88964237 |
| Molecular Formula | C30H35F3O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-[4-[[4-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]cyclohexyl]methoxy]-3-fluorophenyl]oxirane |
| SMILES | C/C=C/C1CCC(c2ccc(C3CCC(COc4ccc(C5CO5)cc4F)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H35F3O2/c1-2-3-19-4-8-21(9-5-19)24-13-14-25(30(33)29(24)32)22-10-6-20(7-11-22)17-34-27-15-12-23(16-26(27)31)28-18-35-28/h2-3,12-16,19-22,28H,4-11,17-18H2,1H3/b3-2+ |
| InChIKey | PCCUOFQHTYAVNO-NSCUHMNNSA-N |
| XLogP | 8.38 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|