C31H39F3O3 — CID 88964222
1-[4-[2,3-difluoro-4-[4-[[2-fluoro-4-(oxiran-2-yl)phenoxy]methyl]cyclohexyl]phenyl]cyclohexyl]butan-1-ol (PubChem CID 88964222) has the molecular formula C31H39F3O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[4-[[2-fluoro-4-(oxiran-2-yl)phenoxy]methyl]cyclohexyl]phenyl]cyclohexyl]butan-1-ol.
| Compound Name | 1-[4-[2,3-difluoro-4-[4-[[2-fluoro-4-(oxiran-2-yl)phenoxy]methyl]cyclohexyl]phenyl]cyclohexyl]butan-1-ol |
|---|---|
| PubChem CID | 88964222 |
| Molecular Formula | C31H39F3O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[4-[[2-fluoro-4-(oxiran-2-yl)phenoxy]methyl]cyclohexyl]phenyl]cyclohexyl]butan-1-ol |
| SMILES | CCCC(O)C1CCC(c2ccc(C3CCC(COc4ccc(C5CO5)cc4F)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C31H39F3O3/c1-2-3-27(35)22-10-8-21(9-11-22)25-14-13-24(30(33)31(25)34)20-6-4-19(5-7-20)17-36-28-15-12-23(16-26(28)32)29-18-37-29/h12-16,19-22,27,29,35H,2-11,17-18H2,1H3 |
| InChIKey | MNKPNTOVSLRCNR-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|