C17H24F2O2 — CID 118967053
1-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]propan-1-ol (PubChem CID 118967053) has the molecular formula C17H24F2O2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]propan-1-ol.
| Compound Name | 1-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]propan-1-ol |
|---|---|
| PubChem CID | 118967053 |
| Molecular Formula | C17H24F2O2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]propan-1-ol |
| SMILES | CCOc1ccc(C2CCC(C(O)CC)CC2)c(F)c1F |
| InChI | InChI=1S/C17H24F2O2/c1-3-14(20)12-7-5-11(6-8-12)13-9-10-15(21-4-2)17(19)16(13)18/h9-12,14,20H,3-8H2,1-2H3 |
| InChIKey | LMMGPGHONHONTK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |