C29H26F6O4 — CID 88857201
[4-[4-[2,3-difluoro-4-(1-hydroxyethyl)phenyl]cyclohexyl]-2,3-difluorophenyl] 4-ethoxy-2,3-difluorobenzoate (PubChem CID 88857201) has the molecular formula C29H26F6O4 and a molecular weight of 552.51 g/mol. Its IUPAC name is [4-[4-[2,3-difluoro-4-(1-hydroxyethyl)phenyl]cyclohexyl]-2,3-difluorophenyl] 4-ethoxy-2,3-difluorobenzoate.
| Compound Name | [4-[4-[2,3-difluoro-4-(1-hydroxyethyl)phenyl]cyclohexyl]-2,3-difluorophenyl] 4-ethoxy-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 88857201 |
| Molecular Formula | C29H26F6O4 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [4-[4-[2,3-difluoro-4-(1-hydroxyethyl)phenyl]cyclohexyl]-2,3-difluorophenyl] 4-ethoxy-2,3-difluorobenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C3CCC(c4ccc(C(C)O)c(F)c4F)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C29H26F6O4/c1-3-38-21-12-11-20(26(33)27(21)34)29(37)39-22-13-10-19(25(32)28(22)35)16-6-4-15(5-7-16)18-9-8-17(14(2)36)23(30)24(18)31/h8-16,36H,3-7H2,1-2H3 |
| InChIKey | DLPZLGGQGBDYOW-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|