C29H24F6O3 — CID 88856517
[4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-propoxybenzoate (PubChem CID 88856517) has the molecular formula C29H24F6O3 and a molecular weight of 534.50 g/mol. Its IUPAC name is [4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-propoxybenzoate.
| Compound Name | [4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-propoxybenzoate |
|---|---|
| PubChem CID | 88856517 |
| Molecular Formula | C29H24F6O3 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(C3=CCC(c4ccc(C)c(F)c4F)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C29H24F6O3/c1-3-14-37-21-12-11-20(26(33)27(21)34)29(36)38-22-13-10-19(25(32)28(22)35)17-7-5-16(6-8-17)18-9-4-15(2)23(30)24(18)31/h4,7,9-13,16H,3,5-6,8,14H2,1-2H3 |
| InChIKey | XUZHRRSCWDUOAO-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|