C29H26F6O — CID 88856316
1-butoxy-4-[4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl]-2,3-difluorobenzene (PubChem CID 88856316) has the molecular formula C29H26F6O and a molecular weight of 504.51 g/mol. Its IUPAC name is 1-butoxy-4-[4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 88856316 |
| Molecular Formula | C29H26F6O |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1-butoxy-4-[4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl]-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(-c2ccc(C3=CCC(c4ccc(C)c(F)c4F)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C29H26F6O/c1-3-4-15-36-23-14-13-22(28(34)29(23)35)21-12-11-20(26(32)27(21)33)18-8-6-17(7-9-18)19-10-5-16(2)24(30)25(19)31/h5,8,10-14,17H,3-4,6-7,9,15H2,1-2H3 |
| InChIKey | YMVLZYHGXYKUJU-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|