C32H30F6O3 — CID 88856521
[4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-hexoxybenzoate (PubChem CID 88856521) has the molecular formula C32H30F6O3 and a molecular weight of 576.58 g/mol. Its IUPAC name is [4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-hexoxybenzoate.
| Compound Name | [4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-hexoxybenzoate |
|---|---|
| PubChem CID | 88856521 |
| Molecular Formula | C32H30F6O3 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | [4-[4-(2,3-difluoro-4-methylphenyl)cyclohexen-1-yl]-2,3-difluorophenyl] 2,3-difluoro-4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(C3=CCC(c4ccc(C)c(F)c4F)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H30F6O3/c1-3-4-5-6-17-40-24-15-14-23(29(36)30(24)37)32(39)41-25-16-13-22(28(35)31(25)38)20-10-8-19(9-11-20)21-12-7-18(2)26(33)27(21)34/h7,10,12-16,19H,3-6,8-9,11,17H2,1-2H3 |
| InChIKey | ZJGDHZIWZFXAMT-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|