C27H20F6O2 — CID 88967719
2-[4-[4-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88967719) has the molecular formula C27H20F6O2 and a molecular weight of 490.44 g/mol. Its IUPAC name is 2-[4-[4-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88967719 |
| Molecular Formula | C27H20F6O2 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[4-[4-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
| SMILES | COc1ccc(C2=CCC(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C27H20F6O2/c1-34-20-11-10-16(23(29)27(20)33)14-4-2-13(3-5-14)15-6-7-17(24(30)22(15)28)18-8-9-19(21-12-35-21)26(32)25(18)31/h4,6-11,13,21H,2-3,5,12H2,1H3 |
| InChIKey | SKGWAHQNVUFXPU-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|