C32H31F5O2 — CID 88857796
1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]hexan-1-ol (PubChem CID 88857796) has the molecular formula C32H31F5O2 and a molecular weight of 542.59 g/mol. Its IUPAC name is 1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]hexan-1-ol.
| Compound Name | 1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]hexan-1-ol |
|---|---|
| PubChem CID | 88857796 |
| Molecular Formula | C32H31F5O2 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 1-[4-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]-2,3-difluorophenyl]hexan-1-ol |
| SMILES | CCCCCC(O)c1ccc(C2CC=C(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C32H31F5O2/c1-2-3-4-5-27(38)24-14-12-21(29(34)31(24)36)19-8-6-18(7-9-19)20-10-11-22(26(33)16-20)23-13-15-25(28-17-39-28)32(37)30(23)35/h6,10-16,19,27-28,38H,2-5,7-9,17H2,1H3 |
| InChIKey | BMCANWFGBGRRJU-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|