C37H40F4O4 — CID 88893832
[4-[2,3-difluoro-4-(1-hydroxybutyl)phenyl]phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]cyclohexane-1-carboxylate (PubChem CID 88893832) has the molecular formula C37H40F4O4 and a molecular weight of 624.72 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(1-hydroxybutyl)phenyl]phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]cyclohexane-1-carboxylate.
| Compound Name | [4-[2,3-difluoro-4-(1-hydroxybutyl)phenyl]phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88893832 |
| Molecular Formula | C37H40F4O4 |
| Molecular Weight | 624.72 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | [4-[2,3-difluoro-4-(1-hydroxybutyl)phenyl]phenyl] 4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]cyclohexane-1-carboxylate |
| SMILES | CCCC(O)c1ccc(-c2ccc(OC(=O)C3CCC(C4CCC(c5ccc(C6CO6)c(F)c5F)CC4)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C37H40F4O4/c1-2-3-31(42)29-18-16-27(33(38)35(29)40)24-12-14-26(15-13-24)45-37(43)25-10-6-22(7-11-25)21-4-8-23(9-5-21)28-17-19-30(32-20-44-32)36(41)34(28)39/h12-19,21-23,25,31-32,42H,2-11,20H2,1H3 |
| InChIKey | MLRRCWQLMNUZTH-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.72 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|