C31H33F3O4 — CID 89430944
(4-ethoxy-2-fluorophenyl) 4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexane-1-carboxylate (PubChem CID 89430944) has the molecular formula C31H33F3O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is (4-ethoxy-2-fluorophenyl) 4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexane-1-carboxylate.
| Compound Name | (4-ethoxy-2-fluorophenyl) 4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89430944 |
| Molecular Formula | C31H33F3O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (4-ethoxy-2-fluorophenyl) 4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexane-1-carboxylate |
| SMILES | CCCCOc1ccc(-c2ccc(C3CCC(C(=O)Oc4ccc(OCC)cc4F)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C31H33F3O4/c1-3-5-18-37-23-12-10-21(11-13-23)26-16-15-25(29(33)30(26)34)20-6-8-22(9-7-20)31(35)38-28-17-14-24(36-4-2)19-27(28)32/h10-17,19-20,22H,3-9,18H2,1-2H3 |
| InChIKey | WURCFWGSTXGZEC-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|