About [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate
[4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate (PubChem CID 141271545) has the molecular formula C21H21F3O3
and a molecular weight of 378.39 g/mol. Its IUPAC name is [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate |
| PubChem CID | 141271545 |
| Molecular Formula | C21H21F3O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate |
| SMILES | CCOc1ccc(-c2ccc(OC(=O)C3CCCCC3)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C21H21F3O3/c1-2-26-18-11-9-15(19(23)20(18)24)14-8-10-17(16(22)12-14)27-21(25)13-6-4-3-5-7-13/h8-13H,2-7H2,1H3 |
| InChIKey | XNJZYUZBBZMHIC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate?
The IUPAC name of [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate (CID 141271545) is [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate.
What is the SMILES notation for [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate?
The canonical SMILES for [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate is CCOc1ccc(-c2ccc(OC(=O)C3CCCCC3)c(F)c2)c(F)c1F.
What is the InChIKey of [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate?
The InChIKey is XNJZYUZBBZMHIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3O3/c1-2-26-18-11-9-15(19(23)20(18)24)14-8-10-17(16(22)12-14)27-21(25)13-6-4-3-5-7-13/h8-13H,2-7H2,1H3.
What are the key properties of [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate?
[4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate has a molecular weight of 378.39 g/mol, XLogP of 5.66, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenyl] cyclohexanecarboxylate is sourced from PubChem (CID 141271545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).