C30H37F3O3 — CID 143777057
[4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 143777057) has the molecular formula C30H37F3O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is [4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 143777057 |
| Molecular Formula | C30H37F3O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | [4-(4-butoxy-3-fluorophenyl)-2,3-difluorophenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCOc1ccc(-c2ccc(OC(=O)C3CCC(C4CCC(C)CC4)CC3)c(F)c2F)cc1F |
| InChI | InChI=1S/C30H37F3O3/c1-3-4-17-35-26-15-13-23(18-25(26)31)24-14-16-27(29(33)28(24)32)36-30(34)22-11-9-21(10-12-22)20-7-5-19(2)6-8-20/h13-16,18-22H,3-12,17H2,1-2H3 |
| InChIKey | GFWQZKQWCLBENC-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|