C33H34F4O4 — CID 89430104
[4-(4-butoxyphenyl)-2,3-difluorophenyl] 4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate (PubChem CID 89430104) has the molecular formula C33H34F4O4 and a molecular weight of 570.62 g/mol. Its IUPAC name is [4-(4-butoxyphenyl)-2,3-difluorophenyl] 4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-butoxyphenyl)-2,3-difluorophenyl] 4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89430104 |
| Molecular Formula | C33H34F4O4 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [4-(4-butoxyphenyl)-2,3-difluorophenyl] 4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate |
| SMILES | C=CCCOc1ccc(C2CCC(C(=O)Oc3ccc(-c4ccc(OCCCC)cc4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C33H34F4O4/c1-3-5-19-39-24-13-11-22(12-14-24)26-16-18-28(32(37)30(26)35)41-33(38)23-9-7-21(8-10-23)25-15-17-27(31(36)29(25)34)40-20-6-4-2/h4,11-18,21,23H,2-3,5-10,19-20H2,1H3 |
| InChIKey | NXQVRCDKNPJLOZ-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|