C31H30F4O4 — CID 89430165
[4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl] 4-(4-ethoxyphenyl)-2,3-difluorobenzoate (PubChem CID 89430165) has the molecular formula C31H30F4O4 and a molecular weight of 542.57 g/mol. Its IUPAC name is [4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl] 4-(4-ethoxyphenyl)-2,3-difluorobenzoate.
| Compound Name | [4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl] 4-(4-ethoxyphenyl)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 89430165 |
| Molecular Formula | C31H30F4O4 |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | [4-(4-but-3-enoxy-2,3-difluorophenyl)cyclohexyl] 4-(4-ethoxyphenyl)-2,3-difluorobenzoate |
| SMILES | C=CCCOc1ccc(C2CCC(OC(=O)c3ccc(-c4ccc(OCC)cc4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C31H30F4O4/c1-3-5-18-38-26-17-16-24(28(33)30(26)35)20-8-12-22(13-9-20)39-31(36)25-15-14-23(27(32)29(25)34)19-6-10-21(11-7-19)37-4-2/h3,6-7,10-11,14-17,20,22H,1,4-5,8-9,12-13,18H2,2H3 |
| InChIKey | NCXFIDQQUFBZBP-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|