C30H28F4O4 — CID 89431112
[4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-prop-2-enoxybenzoate (PubChem CID 89431112) has the molecular formula C30H28F4O4 and a molecular weight of 528.54 g/mol. Its IUPAC name is [4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-prop-2-enoxybenzoate.
| Compound Name | [4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 89431112 |
| Molecular Formula | C30H28F4O4 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [4-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]cyclohexyl] 2,3-difluoro-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OC2CCC(c3ccc(-c4ccc(OCC)cc4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C30H28F4O4/c1-3-17-37-25-16-15-24(28(33)29(25)34)30(35)38-21-11-7-19(8-12-21)23-14-13-22(26(31)27(23)32)18-5-9-20(10-6-18)36-4-2/h3,5-6,9-10,13-16,19,21H,1,4,7-8,11-12,17H2,2H3 |
| InChIKey | KRTONZMWVXCSKV-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|