C31H32F2O3 — CID 154607310
[4-[4-(4-but-3-enylphenyl)phenyl]cyclohexyl] 4-ethoxy-2,3-difluorobenzoate (PubChem CID 154607310) has the molecular formula C31H32F2O3 and a molecular weight of 490.59 g/mol. Its IUPAC name is [4-[4-(4-but-3-enylphenyl)phenyl]cyclohexyl] 4-ethoxy-2,3-difluorobenzoate.
| Compound Name | [4-[4-(4-but-3-enylphenyl)phenyl]cyclohexyl] 4-ethoxy-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 154607310 |
| Molecular Formula | C31H32F2O3 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | [4-[4-(4-but-3-enylphenyl)phenyl]cyclohexyl] 4-ethoxy-2,3-difluorobenzoate |
| SMILES | C=CCCc1ccc(-c2ccc(C3CCC(OC(=O)c4ccc(OCC)c(F)c4F)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H32F2O3/c1-3-5-6-21-7-9-22(10-8-21)23-11-13-24(14-12-23)25-15-17-26(18-16-25)36-31(34)27-19-20-28(35-4-2)30(33)29(27)32/h3,7-14,19-20,25-26H,1,4-6,15-18H2,2H3 |
| InChIKey | WORXCPIVPGWCRB-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|