C20H18F2O — CID 139767130
1-[2-(4-but-3-enylphenyl)ethynyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 139767130) has the molecular formula C20H18F2O and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[2-(4-but-3-enylphenyl)ethynyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[2-(4-but-3-enylphenyl)ethynyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 139767130 |
| Molecular Formula | C20H18F2O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[2-(4-but-3-enylphenyl)ethynyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | C=CCCc1ccc(C#Cc2ccc(OCC)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H18F2O/c1-3-5-6-15-7-9-16(10-8-15)11-12-17-13-14-18(23-4-2)20(22)19(17)21/h3,7-10,13-14H,1,4-6H2,2H3 |
| InChIKey | ADSARDQNZJQTTL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|