C26H20F4O — CID 141431831
1-[2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2,3-difluoro-4-(4-propylphenyl)benzene (PubChem CID 141431831) has the molecular formula C26H20F4O and a molecular weight of 424.44 g/mol. Its IUPAC name is 1-[2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2,3-difluoro-4-(4-propylphenyl)benzene.
| Compound Name | 1-[2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2,3-difluoro-4-(4-propylphenyl)benzene |
|---|---|
| PubChem CID | 141431831 |
| Molecular Formula | C26H20F4O |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[2-(2,3-difluoro-4-prop-2-enoxyphenyl)ethynyl]-2,3-difluoro-4-(4-propylphenyl)benzene |
| SMILES | C=CCOc1ccc(C#Cc2ccc(-c3ccc(CCC)cc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C26H20F4O/c1-3-5-17-6-8-18(9-7-17)21-14-12-19(23(27)25(21)29)10-11-20-13-15-22(31-16-4-2)26(30)24(20)28/h4,6-9,12-15H,2-3,5,16H2,1H3 |
| InChIKey | QRKOZCCLTYUBBR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|