C28H22F4N2O — CID 67732794
2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-propylpyrimidine (PubChem CID 67732794) has the molecular formula C28H22F4N2O and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-propylpyrimidine.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-propylpyrimidine |
|---|---|
| PubChem CID | 67732794 |
| Molecular Formula | C28H22F4N2O |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-propylpyrimidine |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(-c4ncc(CCC)cn4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C28H22F4N2O/c1-3-5-17-15-33-28(34-16-17)22-11-10-20(24(29)26(22)31)18-6-8-19(9-7-18)21-12-13-23(35-14-4-2)27(32)25(21)30/h4,6-13,15-16H,2-3,5,14H2,1H3 |
| InChIKey | DVLNDEMMIHDQBK-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|