C24H34F2N2O — CID 19763062
2-(2,3-difluoro-4-heptoxyphenyl)-5-heptylpyrimidine (PubChem CID 19763062) has the molecular formula C24H34F2N2O and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-heptoxyphenyl)-5-heptylpyrimidine.
| Compound Name | 2-(2,3-difluoro-4-heptoxyphenyl)-5-heptylpyrimidine |
|---|---|
| PubChem CID | 19763062 |
| Molecular Formula | C24H34F2N2O |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 2-(2,3-difluoro-4-heptoxyphenyl)-5-heptylpyrimidine |
| SMILES | CCCCCCCOc1ccc(-c2ncc(CCCCCCC)cn2)c(F)c1F |
| InChI | InChI=1S/C24H34F2N2O/c1-3-5-7-9-11-13-19-17-27-24(28-18-19)20-14-15-21(23(26)22(20)25)29-16-12-10-8-6-4-2/h14-15,17-18H,3-13,16H2,1-2H3 |
| InChIKey | ZBQLFGXKUXCJAA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|