C29H42F2N2O — CID 21197075
2-(4-decoxy-2,3-difluorophenyl)-5-[(E)-non-1-enyl]pyrimidine (PubChem CID 21197075) has the molecular formula C29H42F2N2O and a molecular weight of 472.66 g/mol. Its IUPAC name is 2-(4-decoxy-2,3-difluorophenyl)-5-[(E)-non-1-enyl]pyrimidine.
| Compound Name | 2-(4-decoxy-2,3-difluorophenyl)-5-[(E)-non-1-enyl]pyrimidine |
|---|---|
| PubChem CID | 21197075 |
| Molecular Formula | C29H42F2N2O |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | 2-(4-decoxy-2,3-difluorophenyl)-5-[(E)-non-1-enyl]pyrimidine |
| SMILES | CCCCCCC/C=C/c1cnc(-c2ccc(OCCCCCCCCCC)c(F)c2F)nc1 |
| InChI | InChI=1S/C29H42F2N2O/c1-3-5-7-9-11-13-15-17-21-34-26-20-19-25(27(30)28(26)31)29-32-22-24(23-33-29)18-16-14-12-10-8-6-4-2/h16,18-20,22-23H,3-15,17,21H2,1-2H3/b18-16+ |
| InChIKey | UWHCAABIIIASMB-FBMGVBCBSA-N |
| XLogP | 9.31 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|