C26H35F3N2 — CID 67627529
2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-non-1-enylpyrimidine (PubChem CID 67627529) has the molecular formula C26H35F3N2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-non-1-enylpyrimidine.
| Compound Name | 2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-non-1-enylpyrimidine |
|---|---|
| PubChem CID | 67627529 |
| Molecular Formula | C26H35F3N2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-non-1-enylpyrimidine |
| SMILES | CCCCCCCC=Cc1cnc(-c2ccc(CCCCCC(C)F)c(F)c2F)nc1 |
| InChI | InChI=1S/C26H35F3N2/c1-3-4-5-6-7-8-11-14-21-18-30-26(31-19-21)23-17-16-22(24(28)25(23)29)15-12-9-10-13-20(2)27/h11,14,16-20H,3-10,12-13,15H2,1-2H3 |
| InChIKey | ZDYKHWMFIXFEFL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|