C26H37F3N2 — CID 21197036
2-(4-decyl-2,3-difluorophenyl)-5-(5-fluorohexyl)pyrimidine (PubChem CID 21197036) has the molecular formula C26H37F3N2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 2-(4-decyl-2,3-difluorophenyl)-5-(5-fluorohexyl)pyrimidine.
| Compound Name | 2-(4-decyl-2,3-difluorophenyl)-5-(5-fluorohexyl)pyrimidine |
|---|---|
| PubChem CID | 21197036 |
| Molecular Formula | C26H37F3N2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 2-(4-decyl-2,3-difluorophenyl)-5-(5-fluorohexyl)pyrimidine |
| SMILES | CCCCCCCCCCc1ccc(-c2ncc(CCCCC(C)F)cn2)c(F)c1F |
| InChI | InChI=1S/C26H37F3N2/c1-3-4-5-6-7-8-9-10-15-22-16-17-23(25(29)24(22)28)26-30-18-21(19-31-26)14-12-11-13-20(2)27/h16-20H,3-15H2,1-2H3 |
| InChIKey | DQGIJCAOCOQMFW-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|