C25H35F3N2O — CID 21197146
2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-octoxypyrimidine (PubChem CID 21197146) has the molecular formula C25H35F3N2O and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-octoxypyrimidine.
| Compound Name | 2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-octoxypyrimidine |
|---|---|
| PubChem CID | 21197146 |
| Molecular Formula | C25H35F3N2O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 2-[2,3-difluoro-4-(6-fluoroheptyl)phenyl]-5-octoxypyrimidine |
| SMILES | CCCCCCCCOc1cnc(-c2ccc(CCCCCC(C)F)c(F)c2F)nc1 |
| InChI | InChI=1S/C25H35F3N2O/c1-3-4-5-6-7-11-16-31-21-17-29-25(30-18-21)22-15-14-20(23(27)24(22)28)13-10-8-9-12-19(2)26/h14-15,17-19H,3-13,16H2,1-2H3 |
| InChIKey | UILATVMIBLCLLL-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|