C23H31F3N2O — CID 54370938
2-(2,3-difluoro-4-pentylphenyl)-5-(2-fluorooctoxy)pyrimidine (PubChem CID 54370938) has the molecular formula C23H31F3N2O and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-pentylphenyl)-5-(2-fluorooctoxy)pyrimidine.
| Compound Name | 2-(2,3-difluoro-4-pentylphenyl)-5-(2-fluorooctoxy)pyrimidine |
|---|---|
| PubChem CID | 54370938 |
| Molecular Formula | C23H31F3N2O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-(2,3-difluoro-4-pentylphenyl)-5-(2-fluorooctoxy)pyrimidine |
| SMILES | CCCCCCC(F)COc1cnc(-c2ccc(CCCCC)c(F)c2F)nc1 |
| InChI | InChI=1S/C23H31F3N2O/c1-3-5-7-9-11-18(24)16-29-19-14-27-23(28-15-19)20-13-12-17(10-8-6-4-2)21(25)22(20)26/h12-15,18H,3-11,16H2,1-2H3 |
| InChIKey | UTDJXPOYUFDCGQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|