C26H38F2N2O3 — CID 57075266
7-fluoro-8-[2-(2-fluoro-4-octoxyphenyl)pyrimidin-5-yl]oxyoctan-4-ol (PubChem CID 57075266) has the molecular formula C26H38F2N2O3 and a molecular weight of 464.60 g/mol. Its IUPAC name is 7-fluoro-8-[2-(2-fluoro-4-octoxyphenyl)pyrimidin-5-yl]oxyoctan-4-ol.
| Compound Name | 7-fluoro-8-[2-(2-fluoro-4-octoxyphenyl)pyrimidin-5-yl]oxyoctan-4-ol |
|---|---|
| PubChem CID | 57075266 |
| Molecular Formula | C26H38F2N2O3 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 7-fluoro-8-[2-(2-fluoro-4-octoxyphenyl)pyrimidin-5-yl]oxyoctan-4-ol |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(OCC(F)CCC(O)CCC)cn2)c(F)c1 |
| InChI | InChI=1S/C26H38F2N2O3/c1-3-5-6-7-8-9-15-32-22-13-14-24(25(28)16-22)26-29-17-23(18-30-26)33-19-20(27)11-12-21(31)10-4-2/h13-14,16-18,20-21,31H,3-12,15,19H2,1-2H3 |
| InChIKey | FHKQTFRRLPJTTM-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|