C26H34F6N2O2 — CID 102091638
2-[4-(2-fluorooctoxy)phenyl]-5-(7,7,8,8,8-pentafluorooctoxy)pyrimidine (PubChem CID 102091638) has the molecular formula C26H34F6N2O2 and a molecular weight of 520.56 g/mol. Its IUPAC name is 2-[4-(2-fluorooctoxy)phenyl]-5-(7,7,8,8,8-pentafluorooctoxy)pyrimidine.
| Compound Name | 2-[4-(2-fluorooctoxy)phenyl]-5-(7,7,8,8,8-pentafluorooctoxy)pyrimidine |
|---|---|
| PubChem CID | 102091638 |
| Molecular Formula | C26H34F6N2O2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-[4-(2-fluorooctoxy)phenyl]-5-(7,7,8,8,8-pentafluorooctoxy)pyrimidine |
| SMILES | CCCCCCC(F)COc1ccc(-c2ncc(OCCCCCCC(F)(F)C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C26H34F6N2O2/c1-2-3-4-7-10-21(27)19-36-22-13-11-20(12-14-22)24-33-17-23(18-34-24)35-16-9-6-5-8-15-25(28,29)26(30,31)32/h11-14,17-18,21H,2-10,15-16,19H2,1H3 |
| InChIKey | VNZCHOYZOGMVHY-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|