C28H34F2N2O — CID 19771458
2-[2,3-difluoro-4-(4-pentoxyphenyl)phenyl]-5-heptylpyrimidine (PubChem CID 19771458) has the molecular formula C28H34F2N2O and a molecular weight of 452.59 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(4-pentoxyphenyl)phenyl]-5-heptylpyrimidine.
| Compound Name | 2-[2,3-difluoro-4-(4-pentoxyphenyl)phenyl]-5-heptylpyrimidine |
|---|---|
| PubChem CID | 19771458 |
| Molecular Formula | C28H34F2N2O |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 2-[2,3-difluoro-4-(4-pentoxyphenyl)phenyl]-5-heptylpyrimidine |
| SMILES | CCCCCCCc1cnc(-c2ccc(-c3ccc(OCCCCC)cc3)c(F)c2F)nc1 |
| InChI | InChI=1S/C28H34F2N2O/c1-3-5-7-8-9-11-21-19-31-28(32-20-21)25-17-16-24(26(29)27(25)30)22-12-14-23(15-13-22)33-18-10-6-4-2/h12-17,19-20H,3-11,18H2,1-2H3 |
| InChIKey | VKQNFMVTFJDOSC-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|