C27H32F2N2 — CID 19103459
2-[4-(4-butyl-2,3-difluorophenyl)phenyl]-5-heptylpyrimidine (PubChem CID 19103459) has the molecular formula C27H32F2N2 and a molecular weight of 422.56 g/mol. Its IUPAC name is 2-[4-(4-butyl-2,3-difluorophenyl)phenyl]-5-heptylpyrimidine.
| Compound Name | 2-[4-(4-butyl-2,3-difluorophenyl)phenyl]-5-heptylpyrimidine |
|---|---|
| PubChem CID | 19103459 |
| Molecular Formula | C27H32F2N2 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[4-(4-butyl-2,3-difluorophenyl)phenyl]-5-heptylpyrimidine |
| SMILES | CCCCCCCc1cnc(-c2ccc(-c3ccc(CCCC)c(F)c3F)cc2)nc1 |
| InChI | InChI=1S/C27H32F2N2/c1-3-5-7-8-9-10-20-18-30-27(31-19-20)23-14-12-21(13-15-23)24-17-16-22(11-6-4-2)25(28)26(24)29/h12-19H,3-11H2,1-2H3 |
| InChIKey | WXKVWOAQXHSJHB-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|