C31H41F2N3O — CID 19359112
5-(4-decyl-2,3-difluorophenyl)-2-(6-hexoxy-3-pyridinyl)pyrimidine (PubChem CID 19359112) has the molecular formula C31H41F2N3O and a molecular weight of 509.69 g/mol. Its IUPAC name is 5-(4-decyl-2,3-difluorophenyl)-2-(6-hexoxy-3-pyridinyl)pyrimidine.
| Compound Name | 5-(4-decyl-2,3-difluorophenyl)-2-(6-hexoxy-3-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 19359112 |
| Molecular Formula | C31H41F2N3O |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | 5-(4-decyl-2,3-difluorophenyl)-2-(6-hexoxy-3-pyridinyl)pyrimidine |
| SMILES | CCCCCCCCCCc1ccc(-c2cnc(-c3ccc(OCCCCCC)nc3)nc2)c(F)c1F |
| InChI | InChI=1S/C31H41F2N3O/c1-3-5-7-9-10-11-12-13-15-24-16-18-27(30(33)29(24)32)26-22-35-31(36-23-26)25-17-19-28(34-21-25)37-20-14-8-6-4-2/h16-19,21-23H,3-15,20H2,1-2H3 |
| InChIKey | YOASNTFKLARVNN-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|