C24H22F4 — CID 146536354
1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-pentylbenzene (PubChem CID 146536354) has the molecular formula C24H22F4 and a molecular weight of 386.43 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-pentylbenzene.
| Compound Name | 1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-pentylbenzene |
|---|---|
| PubChem CID | 146536354 |
| Molecular Formula | C24H22F4 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-pentylbenzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C24H22F4/c1-3-4-5-6-18-12-14-20(24(28)22(18)26)17-10-8-16(9-11-17)19-13-7-15(2)21(25)23(19)27/h7-14H,3-6H2,1-2H3 |
| InChIKey | QAPLKFDUPJZBDN-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|