C19H22F2 — CID 118911713
1-ethyl-2,3-difluoro-4-(4-pentylphenyl)benzene (PubChem CID 118911713) has the molecular formula C19H22F2 and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-ethyl-2,3-difluoro-4-(4-pentylphenyl)benzene.
| Compound Name | 1-ethyl-2,3-difluoro-4-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 118911713 |
| Molecular Formula | C19H22F2 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-ethyl-2,3-difluoro-4-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2ccc(CC)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H22F2/c1-3-5-6-7-14-8-10-16(11-9-14)17-13-12-15(4-2)18(20)19(17)21/h8-13H,3-7H2,1-2H3 |
| InChIKey | YKOUUUOJVNSUSY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|