C15H14F2 — CID 20727464
1-ethyl-2,3-difluoro-4-(4-methylphenyl)benzene (PubChem CID 20727464) has the molecular formula C15H14F2 and a molecular weight of 232.27 g/mol. Its IUPAC name is 1-ethyl-2,3-difluoro-4-(4-methylphenyl)benzene.
| Compound Name | 1-ethyl-2,3-difluoro-4-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 20727464 |
| Molecular Formula | C15H14F2 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-ethyl-2,3-difluoro-4-(4-methylphenyl)benzene |
| SMILES | CCc1ccc(-c2ccc(C)cc2)c(F)c1F |
| InChI | InChI=1S/C15H14F2/c1-3-11-8-9-13(15(17)14(11)16)12-6-4-10(2)5-7-12/h4-9H,3H2,1-2H3 |
| InChIKey | PUGLEZNOXFVKJF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |