C17H16F2O — CID 142331657
1-[4-(2,3-difluoro-4-propylphenyl)phenyl]ethanone (PubChem CID 142331657) has the molecular formula C17H16F2O and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-propylphenyl)phenyl]ethanone.
| Compound Name | 1-[4-(2,3-difluoro-4-propylphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 142331657 |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-propylphenyl)phenyl]ethanone |
| SMILES | CCCc1ccc(-c2ccc(C(C)=O)cc2)c(F)c1F |
| InChI | InChI=1S/C17H16F2O/c1-3-4-14-9-10-15(17(19)16(14)18)13-7-5-12(6-8-13)11(2)20/h5-10H,3-4H2,1-2H3 |
| InChIKey | QEKJXNYFNMODIM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |