C25H21F3 — CID 58141688
1-[4-[2-(4-ethyl-3-fluorophenyl)ethynyl]phenyl]-2,3-difluoro-4-propylbenzene (PubChem CID 58141688) has the molecular formula C25H21F3 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-[4-[2-(4-ethyl-3-fluorophenyl)ethynyl]phenyl]-2,3-difluoro-4-propylbenzene.
| Compound Name | 1-[4-[2-(4-ethyl-3-fluorophenyl)ethynyl]phenyl]-2,3-difluoro-4-propylbenzene |
|---|---|
| PubChem CID | 58141688 |
| Molecular Formula | C25H21F3 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[4-[2-(4-ethyl-3-fluorophenyl)ethynyl]phenyl]-2,3-difluoro-4-propylbenzene |
| SMILES | CCCc1ccc(-c2ccc(C#Cc3ccc(CC)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C25H21F3/c1-3-5-21-14-15-22(25(28)24(21)27)20-12-8-17(9-13-20)6-7-18-10-11-19(4-2)23(26)16-18/h8-16H,3-5H2,1-2H3 |
| InChIKey | RMROGMMFYFVLET-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|