C24H20F4O2 — CID 118858708
(3,4-difluorophenyl) 3-[4-(2,3-difluoro-4-propylphenyl)phenyl]propanoate (PubChem CID 118858708) has the molecular formula C24H20F4O2 and a molecular weight of 416.41 g/mol. Its IUPAC name is (3,4-difluorophenyl) 3-[4-(2,3-difluoro-4-propylphenyl)phenyl]propanoate.
| Compound Name | (3,4-difluorophenyl) 3-[4-(2,3-difluoro-4-propylphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 118858708 |
| Molecular Formula | C24H20F4O2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (3,4-difluorophenyl) 3-[4-(2,3-difluoro-4-propylphenyl)phenyl]propanoate |
| SMILES | CCCc1ccc(-c2ccc(CCC(=O)Oc3ccc(F)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C24H20F4O2/c1-2-3-17-9-11-19(24(28)23(17)27)16-7-4-15(5-8-16)6-13-22(29)30-18-10-12-20(25)21(26)14-18/h4-5,7-12,14H,2-3,6,13H2,1H3 |
| InChIKey | HAOOFCDQYOCJSW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|